About 6-[2-bromo-5-(trifluoromethyl)phenyl]-3-fluoro-1-oxido-1,2-dihydropyridin-1-ium
6-[2-bromo-5-(trifluoromethyl)phenyl]-3-fluoro-1-oxido-1,2-dihydropyridin-1-ium (PubChem CID 126668872) has the molecular formula C12H8BrF4NO
and a molecular weight of 338.10 g/mol. Its IUPAC name is 6-[2-bromo-5-(trifluoromethyl)phenyl]-3-fluoro-1-oxido-1,2-dihydropyridin-1-ium.
Molecular Properties
| Compound Name | 6-[2-bromo-5-(trifluoromethyl)phenyl]-3-fluoro-1-oxido-1,2-dihydropyridin-1-ium |
| PubChem CID | 126668872 |
| Molecular Formula | C12H8BrF4NO |
| Molecular Weight | 338.10 g/mol |
| Exact Mass | 336.97 |
| IUPAC Name | 6-[2-bromo-5-(trifluoromethyl)phenyl]-3-fluoro-1-oxido-1,2-dihydropyridin-1-ium |
| SMILES | [O-][NH+]1CC(F)=CC=C1c1cc(C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C12H8BrF4NO/c13-10-3-1-7(12(15,16)17)5-9(10)11-4-2-8(14)6-18(11)19/h1-5,18H,6H2 |
| InChIKey | DKPUQXXWGHPTJB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 27.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.10 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-[2-bromo-5-(trifluoromethyl)phenyl]-3-fluoro-1-oxido-1,2-dihydropyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-bromo-5-(trifluoromethyl)phenyl]-3-fluoro-1-oxido-1,2-dihydropyridin-1-ium?
The IUPAC name of 6-[2-bromo-5-(trifluoromethyl)phenyl]-3-fluoro-1-oxido-1,2-dihydropyridin-1-ium (CID 126668872) is 6-[2-bromo-5-(trifluoromethyl)phenyl]-3-fluoro-1-oxido-1,2-dihydropyridin-1-ium.
What is the SMILES notation for 6-[2-bromo-5-(trifluoromethyl)phenyl]-3-fluoro-1-oxido-1,2-dihydropyridin-1-ium?
The canonical SMILES for 6-[2-bromo-5-(trifluoromethyl)phenyl]-3-fluoro-1-oxido-1,2-dihydropyridin-1-ium is [O-][NH+]1CC(F)=CC=C1c1cc(C(F)(F)F)ccc1Br.
What is the InChIKey of 6-[2-bromo-5-(trifluoromethyl)phenyl]-3-fluoro-1-oxido-1,2-dihydropyridin-1-ium?
The InChIKey is DKPUQXXWGHPTJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8BrF4NO/c13-10-3-1-7(12(15,16)17)5-9(10)11-4-2-8(14)6-18(11)19/h1-5,18H,6H2.
What are the key properties of 6-[2-bromo-5-(trifluoromethyl)phenyl]-3-fluoro-1-oxido-1,2-dihydropyridin-1-ium?
6-[2-bromo-5-(trifluoromethyl)phenyl]-3-fluoro-1-oxido-1,2-dihydropyridin-1-ium has a molecular weight of 338.10 g/mol, XLogP of 3.06, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-bromo-5-(trifluoromethyl)phenyl]-3-fluoro-1-oxido-1,2-dihydropyridin-1-ium is sourced from PubChem (CID 126668872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).