About [5-[(3-ethoxy-1,2-benzoxazol-6-yl)oxy]-3-methylpentoxy] thiohypoiodite
[5-[(3-ethoxy-1,2-benzoxazol-6-yl)oxy]-3-methylpentoxy] thiohypoiodite (PubChem CID 126669035) has the molecular formula C15H20INO4S
and a molecular weight of 437.30 g/mol. Its IUPAC name is [5-[(3-ethoxy-1,2-benzoxazol-6-yl)oxy]-3-methylpentoxy] thiohypoiodite.
Molecular Properties
| Compound Name | [5-[(3-ethoxy-1,2-benzoxazol-6-yl)oxy]-3-methylpentoxy] thiohypoiodite |
| PubChem CID | 126669035 |
| Molecular Formula | C15H20INO4S |
| Molecular Weight | 437.30 g/mol |
| Exact Mass | 437.02 |
| IUPAC Name | [5-[(3-ethoxy-1,2-benzoxazol-6-yl)oxy]-3-methylpentoxy] thiohypoiodite |
| SMILES | CCOc1noc2cc(OCCC(C)CCOSI)ccc12 |
| InChI | InChI=1S/C15H20INO4S/c1-3-18-15-13-5-4-12(10-14(13)21-17-15)19-8-6-11(2)7-9-20-22-16/h4-5,10-11H,3,6-9H2,1-2H3 |
| InChIKey | FZOAUJYVCMXSJI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 53.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.30 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-[(3-ethoxy-1,2-benzoxazol-6-yl)oxy]-3-methylpentoxy] thiohypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(3-ethoxy-1,2-benzoxazol-6-yl)oxy]-3-methylpentoxy] thiohypoiodite?
The IUPAC name of [5-[(3-ethoxy-1,2-benzoxazol-6-yl)oxy]-3-methylpentoxy] thiohypoiodite (CID 126669035) is [5-[(3-ethoxy-1,2-benzoxazol-6-yl)oxy]-3-methylpentoxy] thiohypoiodite.
What is the SMILES notation for [5-[(3-ethoxy-1,2-benzoxazol-6-yl)oxy]-3-methylpentoxy] thiohypoiodite?
The canonical SMILES for [5-[(3-ethoxy-1,2-benzoxazol-6-yl)oxy]-3-methylpentoxy] thiohypoiodite is CCOc1noc2cc(OCCC(C)CCOSI)ccc12.
What is the InChIKey of [5-[(3-ethoxy-1,2-benzoxazol-6-yl)oxy]-3-methylpentoxy] thiohypoiodite?
The InChIKey is FZOAUJYVCMXSJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20INO4S/c1-3-18-15-13-5-4-12(10-14(13)21-17-15)19-8-6-11(2)7-9-20-22-16/h4-5,10-11H,3,6-9H2,1-2H3.
What are the key properties of [5-[(3-ethoxy-1,2-benzoxazol-6-yl)oxy]-3-methylpentoxy] thiohypoiodite?
[5-[(3-ethoxy-1,2-benzoxazol-6-yl)oxy]-3-methylpentoxy] thiohypoiodite has a molecular weight of 437.30 g/mol, XLogP of 5.04, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(3-ethoxy-1,2-benzoxazol-6-yl)oxy]-3-methylpentoxy] thiohypoiodite is sourced from PubChem (CID 126669035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).