C14H16F3N3O2 — CID 126669250
methoxy-[4-[1-(4,4,4-trifluorobutyl)-1,2,4-triazol-3-yl]phenyl]methanol (PubChem CID 126669250) has the molecular formula C14H16F3N3O2 and a molecular weight of 315.29 g/mol. Its IUPAC name is methoxy-[4-[1-(4,4,4-trifluorobutyl)-1,2,4-triazol-3-yl]phenyl]methanol.
| Compound Name | methoxy-[4-[1-(4,4,4-trifluorobutyl)-1,2,4-triazol-3-yl]phenyl]methanol |
|---|---|
| PubChem CID | 126669250 |
| Molecular Formula | C14H16F3N3O2 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | methoxy-[4-[1-(4,4,4-trifluorobutyl)-1,2,4-triazol-3-yl]phenyl]methanol |
| SMILES | COC(O)c1ccc(-c2ncn(CCCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C14H16F3N3O2/c1-22-13(21)11-5-3-10(4-6-11)12-18-9-20(19-12)8-2-7-14(15,16)17/h3-6,9,13,21H,2,7-8H2,1H3 |
| InChIKey | PWFPDTBXMUOJTR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|