C11H18FN — CID 126669258
(1Z,3E,5E)-3-tert-butyl-5-fluorohepta-1,3,5-trien-1-amine (PubChem CID 126669258) has the molecular formula C11H18FN and a molecular weight of 183.27 g/mol. Its IUPAC name is (1Z,3E,5E)-3-tert-butyl-5-fluorohepta-1,3,5-trien-1-amine.
| Compound Name | (1Z,3E,5E)-3-tert-butyl-5-fluorohepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 126669258 |
| Molecular Formula | C11H18FN |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | (1Z,3E,5E)-3-tert-butyl-5-fluorohepta-1,3,5-trien-1-amine |
| SMILES | C/C=C(F)\C=C(/C=C\N)C(C)(C)C |
| InChI | InChI=1S/C11H18FN/c1-5-10(12)8-9(6-7-13)11(2,3)4/h5-8H,13H2,1-4H3/b7-6-,9-8+,10-5+ |
| InChIKey | MDDKCBMNHFJOCZ-IICOLZRNSA-N |
| XLogP | 3.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|