C14H16Cl3N5OS — CID 126669292
2-[3-[5-amino-3-(1-chloropropan-2-ylamino)-1,2,4-triazin-6-yl]-4,5-dichlorophenyl]sulfanylethanol (PubChem CID 126669292) has the molecular formula C14H16Cl3N5OS and a molecular weight of 408.74 g/mol. Its IUPAC name is 2-[3-[5-amino-3-(1-chloropropan-2-ylamino)-1,2,4-triazin-6-yl]-4,5-dichlorophenyl]sulfanylethanol.
| Compound Name | 2-[3-[5-amino-3-(1-chloropropan-2-ylamino)-1,2,4-triazin-6-yl]-4,5-dichlorophenyl]sulfanylethanol |
|---|---|
| PubChem CID | 126669292 |
| Molecular Formula | C14H16Cl3N5OS |
| Molecular Weight | 408.74 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | 2-[3-[5-amino-3-(1-chloropropan-2-ylamino)-1,2,4-triazin-6-yl]-4,5-dichlorophenyl]sulfanylethanol |
| SMILES | CC(CCl)Nc1nnc(-c2cc(SCCO)cc(Cl)c2Cl)c(N)n1 |
| InChI | InChI=1S/C14H16Cl3N5OS/c1-7(6-15)19-14-20-13(18)12(21-22-14)9-4-8(24-3-2-23)5-10(16)11(9)17/h4-5,7,23H,2-3,6H2,1H3,(H3,18,19,20,22) |
| InChIKey | GDXCVPHCDBVJPE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.74 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|