C21H15Cl2F2NO2 — CID 1266698
(4R)-4-(2,4-dichlorophenyl)-1-(2,4-difluorophenyl)-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione (PubChem CID 1266698) has the molecular formula C21H15Cl2F2NO2 and a molecular weight of 422.26 g/mol. Its IUPAC name is (4R)-4-(2,4-dichlorophenyl)-1-(2,4-difluorophenyl)-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione.
| Compound Name | (4R)-4-(2,4-dichlorophenyl)-1-(2,4-difluorophenyl)-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione |
|---|---|
| PubChem CID | 1266698 |
| Molecular Formula | C21H15Cl2F2NO2 |
| Molecular Weight | 422.26 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | (4R)-4-(2,4-dichlorophenyl)-1-(2,4-difluorophenyl)-4,6,7,8-tetrahydro-3H-quinoline-2,5-dione |
| SMILES | O=C1CCCC2=C1[C@H](c1ccc(Cl)cc1Cl)CC(=O)N2c1ccc(F)cc1F |
| InChI | InChI=1S/C21H15Cl2F2NO2/c22-11-4-6-13(15(23)8-11)14-10-20(28)26(17-7-5-12(24)9-16(17)25)18-2-1-3-19(27)21(14)18/h4-9,14H,1-3,10H2/t14-/m0/s1 |
| InChIKey | GLRZMSUIKOIDNM-AWEZNQCLSA-N |
| XLogP | 5.80 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.26 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |