About (2,2-dimethyl-5-methylidenehept-6-enyl)-trimethyl-λ4-sulfane
(2,2-dimethyl-5-methylidenehept-6-enyl)-trimethyl-λ4-sulfane (PubChem CID 126670461) has the molecular formula C13H26S
and a molecular weight of 214.42 g/mol. Its IUPAC name is (2,2-dimethyl-5-methylidenehept-6-enyl)-trimethyl-λ4-sulfane.
Molecular Properties
| Compound Name | (2,2-dimethyl-5-methylidenehept-6-enyl)-trimethyl-λ4-sulfane |
| PubChem CID | 126670461 |
| Molecular Formula | C13H26S |
| Molecular Weight | 214.42 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | (2,2-dimethyl-5-methylidenehept-6-enyl)-trimethyl-λ4-sulfane |
| SMILES | C=CC(=C)CCC(C)(C)CS(C)(C)C |
| InChI | InChI=1S/C13H26S/c1-8-12(2)9-10-13(3,4)11-14(5,6)7/h8H,1-2,9-11H2,3-7H3 |
| InChIKey | YERWBTQMIGWZPN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2,2-dimethyl-5-methylidenehept-6-enyl)-trimethyl-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-dimethyl-5-methylidenehept-6-enyl)-trimethyl-λ4-sulfane?
The IUPAC name of (2,2-dimethyl-5-methylidenehept-6-enyl)-trimethyl-λ4-sulfane (CID 126670461) is (2,2-dimethyl-5-methylidenehept-6-enyl)-trimethyl-λ4-sulfane.
What is the SMILES notation for (2,2-dimethyl-5-methylidenehept-6-enyl)-trimethyl-λ4-sulfane?
The canonical SMILES for (2,2-dimethyl-5-methylidenehept-6-enyl)-trimethyl-λ4-sulfane is C=CC(=C)CCC(C)(C)CS(C)(C)C.
What is the InChIKey of (2,2-dimethyl-5-methylidenehept-6-enyl)-trimethyl-λ4-sulfane?
The InChIKey is YERWBTQMIGWZPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26S/c1-8-12(2)9-10-13(3,4)11-14(5,6)7/h8H,1-2,9-11H2,3-7H3.
What are the key properties of (2,2-dimethyl-5-methylidenehept-6-enyl)-trimethyl-λ4-sulfane?
(2,2-dimethyl-5-methylidenehept-6-enyl)-trimethyl-λ4-sulfane has a molecular weight of 214.42 g/mol, XLogP of 4.23, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dimethyl-5-methylidenehept-6-enyl)-trimethyl-λ4-sulfane is sourced from PubChem (CID 126670461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).