C15H27NO6 — CID 126670549
2-O-butyl 1-O-tert-butyl (2S,4R)-4-hydroxy-4-(hydroxymethyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 126670549) has the molecular formula C15H27NO6 and a molecular weight of 317.38 g/mol. Its IUPAC name is 2-O-butyl 1-O-tert-butyl (2S,4R)-4-hydroxy-4-(hydroxymethyl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-butyl 1-O-tert-butyl (2S,4R)-4-hydroxy-4-(hydroxymethyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 126670549 |
| Molecular Formula | C15H27NO6 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | 2-O-butyl 1-O-tert-butyl (2S,4R)-4-hydroxy-4-(hydroxymethyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | CCCCOC(=O)[C@@H]1C[C@](O)(CO)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27NO6/c1-5-6-7-21-12(18)11-8-15(20,10-17)9-16(11)13(19)22-14(2,3)4/h11,17,20H,5-10H2,1-4H3/t11-,15+/m0/s1 |
| InChIKey | LOAPCPHSIRUJAW-XHDPSFHLSA-N |
| XLogP | 1.06 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|