C15H26FNO5 — CID 126670561
2-O-butyl 1-O-tert-butyl (2S,3S,4S)-4-fluoro-3-methoxypyrrolidine-1,2-dicarboxylate (PubChem CID 126670561) has the molecular formula C15H26FNO5 and a molecular weight of 319.37 g/mol. Its IUPAC name is 2-O-butyl 1-O-tert-butyl (2S,3S,4S)-4-fluoro-3-methoxypyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-butyl 1-O-tert-butyl (2S,3S,4S)-4-fluoro-3-methoxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 126670561 |
| Molecular Formula | C15H26FNO5 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 2-O-butyl 1-O-tert-butyl (2S,3S,4S)-4-fluoro-3-methoxypyrrolidine-1,2-dicarboxylate |
| SMILES | CCCCOC(=O)[C@@H]1[C@H](OC)[C@@H](F)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H26FNO5/c1-6-7-8-21-13(18)11-12(20-5)10(16)9-17(11)14(19)22-15(2,3)4/h10-12H,6-9H2,1-5H3/t10-,11-,12+/m0/s1 |
| InChIKey | MZNAVHMDDCHFDY-SDDRHHMPSA-N |
| XLogP | 2.30 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|