C12H17F3N4O — CID 126670601
(2S,3R,4S)-3,4-dimethyl-N-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyrrolidine-2-carboxamide (PubChem CID 126670601) has the molecular formula C12H17F3N4O and a molecular weight of 290.29 g/mol. Its IUPAC name is (2S,3R,4S)-3,4-dimethyl-N-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,3R,4S)-3,4-dimethyl-N-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 126670601 |
| Molecular Formula | C12H17F3N4O |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | (2S,3R,4S)-3,4-dimethyl-N-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyrrolidine-2-carboxamide |
| SMILES | C[C@@H]1[C@H](C)CN[C@@H]1C(=O)Nc1ccn(CC(F)(F)F)n1 |
| InChI | InChI=1S/C12H17F3N4O/c1-7-5-16-10(8(7)2)11(20)17-9-3-4-19(18-9)6-12(13,14)15/h3-4,7-8,10,16H,5-6H2,1-2H3,(H,17,18,20)/t7-,8-,10+/m1/s1 |
| InChIKey | QMCXGDHLGLGKMJ-MRTMQBJTSA-N |
| XLogP | 1.63 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |