C18H23NO4 — CID 126670991
ethyl (2R,4S)-7-(2-hydroxy-2-phenylethyl)-3-oxa-9-azatricyclo[3.3.1.02,4]nonane-9-carboxylate (PubChem CID 126670991) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is ethyl (2R,4S)-7-(2-hydroxy-2-phenylethyl)-3-oxa-9-azatricyclo[3.3.1.02,4]nonane-9-carboxylate.
| Compound Name | ethyl (2R,4S)-7-(2-hydroxy-2-phenylethyl)-3-oxa-9-azatricyclo[3.3.1.02,4]nonane-9-carboxylate |
|---|---|
| PubChem CID | 126670991 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | ethyl (2R,4S)-7-(2-hydroxy-2-phenylethyl)-3-oxa-9-azatricyclo[3.3.1.02,4]nonane-9-carboxylate |
| SMILES | CCOC(=O)N1C2CC(CC(O)c3ccccc3)CC1[C@@H]1O[C@H]21 |
| InChI | InChI=1S/C18H23NO4/c1-2-22-18(21)19-13-8-11(9-14(19)17-16(13)23-17)10-15(20)12-6-4-3-5-7-12/h3-7,11,13-17,20H,2,8-10H2,1H3/t11?,13?,14?,15?,16-,17+ |
| InChIKey | VBTPHDLWAZQFQI-UUUAEUQSSA-N |
| XLogP | 2.50 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|