C12H27NO2 — CID 126671106
1-aminooxy-2,2,4,4,6-pentamethylheptan-3-ol (PubChem CID 126671106) has the molecular formula C12H27NO2 and a molecular weight of 217.35 g/mol. Its IUPAC name is 1-aminooxy-2,2,4,4,6-pentamethylheptan-3-ol.
| Compound Name | 1-aminooxy-2,2,4,4,6-pentamethylheptan-3-ol |
|---|---|
| PubChem CID | 126671106 |
| Molecular Formula | C12H27NO2 |
| Molecular Weight | 217.35 g/mol |
| Exact Mass | 217.20 |
| IUPAC Name | 1-aminooxy-2,2,4,4,6-pentamethylheptan-3-ol |
| SMILES | CC(C)CC(C)(C)C(O)C(C)(C)CON |
| InChI | InChI=1S/C12H27NO2/c1-9(2)7-11(3,4)10(14)12(5,6)8-15-13/h9-10,14H,7-8,13H2,1-6H3 |
| InChIKey | CZEMXVVABSXFQV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|