C26H31N — CID 126671211
N-[(3Z,6E,8E,9Z)-8-ethylidene-5-methylideneundeca-1,3,6,9-tetraen-2-yl]-N-[(2E,4Z)-hexa-2,4-dien-3-yl]aniline (PubChem CID 126671211) has the molecular formula C26H31N and a molecular weight of 357.54 g/mol. Its IUPAC name is N-[(3Z,6E,8E,9Z)-8-ethylidene-5-methylideneundeca-1,3,6,9-tetraen-2-yl]-N-[(2E,4Z)-hexa-2,4-dien-3-yl]aniline.
| Compound Name | N-[(3Z,6E,8E,9Z)-8-ethylidene-5-methylideneundeca-1,3,6,9-tetraen-2-yl]-N-[(2E,4Z)-hexa-2,4-dien-3-yl]aniline |
|---|---|
| PubChem CID | 126671211 |
| Molecular Formula | C26H31N |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | N-[(3Z,6E,8E,9Z)-8-ethylidene-5-methylideneundeca-1,3,6,9-tetraen-2-yl]-N-[(2E,4Z)-hexa-2,4-dien-3-yl]aniline |
| SMILES | C=C(/C=C\C(=C)N(C(/C=C\C)=C/C)c1ccccc1)/C=C/C(/C=C\C)=C/C |
| InChI | InChI=1S/C26H31N/c1-7-14-24(9-3)21-19-22(5)18-20-23(6)27(25(10-4)15-8-2)26-16-12-11-13-17-26/h7-21H,5-6H2,1-4H3/b14-7-,15-8-,20-18-,21-19+,24-9+,25-10+ |
| InChIKey | KQJMDTINKHOOJO-NARWLWLESA-N |
| XLogP | 7.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|