C14H25N — CID 126671380
(3E,4Z)-2-(2,2-dimethylpropyl)-3-ethylidenehepta-4,6-dien-1-amine (PubChem CID 126671380) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is (3E,4Z)-2-(2,2-dimethylpropyl)-3-ethylidenehepta-4,6-dien-1-amine.
| Compound Name | (3E,4Z)-2-(2,2-dimethylpropyl)-3-ethylidenehepta-4,6-dien-1-amine |
|---|---|
| PubChem CID | 126671380 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | (3E,4Z)-2-(2,2-dimethylpropyl)-3-ethylidenehepta-4,6-dien-1-amine |
| SMILES | C=C/C=C\C(=C/C)C(CN)CC(C)(C)C |
| InChI | InChI=1S/C14H25N/c1-6-8-9-12(7-2)13(11-15)10-14(3,4)5/h6-9,13H,1,10-11,15H2,2-5H3/b9-8-,12-7+ |
| InChIKey | DUFZKZZEEAQUBM-ZHCAKQDLSA-N |
| XLogP | 3.69 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|