About N-tert-butyl-3,3-difluoro-5-[(2-methylpropan-2-yl)oxy]pentan-1-amine
N-tert-butyl-3,3-difluoro-5-[(2-methylpropan-2-yl)oxy]pentan-1-amine (PubChem CID 126671493) has the molecular formula C13H27F2NO
and a molecular weight of 251.36 g/mol. Its IUPAC name is N-tert-butyl-3,3-difluoro-5-[(2-methylpropan-2-yl)oxy]pentan-1-amine.
Molecular Properties
| Compound Name | N-tert-butyl-3,3-difluoro-5-[(2-methylpropan-2-yl)oxy]pentan-1-amine |
| PubChem CID | 126671493 |
| Molecular Formula | C13H27F2NO |
| Molecular Weight | 251.36 g/mol |
| Exact Mass | 251.21 |
| IUPAC Name | N-tert-butyl-3,3-difluoro-5-[(2-methylpropan-2-yl)oxy]pentan-1-amine |
| SMILES | CC(C)(C)NCCC(F)(F)CCOC(C)(C)C |
| InChI | InChI=1S/C13H27F2NO/c1-11(2,3)16-9-7-13(14,15)8-10-17-12(4,5)6/h16H,7-10H2,1-6H3 |
| InChIKey | UGFBFTSKWFLCQP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-tert-butyl-3,3-difluoro-5-[(2-methylpropan-2-yl)oxy]pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-3,3-difluoro-5-[(2-methylpropan-2-yl)oxy]pentan-1-amine?
The IUPAC name of N-tert-butyl-3,3-difluoro-5-[(2-methylpropan-2-yl)oxy]pentan-1-amine (CID 126671493) is N-tert-butyl-3,3-difluoro-5-[(2-methylpropan-2-yl)oxy]pentan-1-amine.
What is the SMILES notation for N-tert-butyl-3,3-difluoro-5-[(2-methylpropan-2-yl)oxy]pentan-1-amine?
The canonical SMILES for N-tert-butyl-3,3-difluoro-5-[(2-methylpropan-2-yl)oxy]pentan-1-amine is CC(C)(C)NCCC(F)(F)CCOC(C)(C)C.
What is the InChIKey of N-tert-butyl-3,3-difluoro-5-[(2-methylpropan-2-yl)oxy]pentan-1-amine?
The InChIKey is UGFBFTSKWFLCQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27F2NO/c1-11(2,3)16-9-7-13(14,15)8-10-17-12(4,5)6/h16H,7-10H2,1-6H3.
What are the key properties of N-tert-butyl-3,3-difluoro-5-[(2-methylpropan-2-yl)oxy]pentan-1-amine?
N-tert-butyl-3,3-difluoro-5-[(2-methylpropan-2-yl)oxy]pentan-1-amine has a molecular weight of 251.36 g/mol, XLogP of 3.61, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-3,3-difluoro-5-[(2-methylpropan-2-yl)oxy]pentan-1-amine is sourced from PubChem (CID 126671493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).