About N-[2-[1-(3,3-dimethylbutyl)piperidin-4-yl]oxyethyl]-2-methylpropan-2-amine
N-[2-[1-(3,3-dimethylbutyl)piperidin-4-yl]oxyethyl]-2-methylpropan-2-amine (PubChem CID 126671625) has the molecular formula C17H36N2O
and a molecular weight of 284.49 g/mol. Its IUPAC name is N-[2-[1-(3,3-dimethylbutyl)piperidin-4-yl]oxyethyl]-2-methylpropan-2-amine.
Molecular Properties
| Compound Name | N-[2-[1-(3,3-dimethylbutyl)piperidin-4-yl]oxyethyl]-2-methylpropan-2-amine |
| PubChem CID | 126671625 |
| Molecular Formula | C17H36N2O |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.28 |
| IUPAC Name | N-[2-[1-(3,3-dimethylbutyl)piperidin-4-yl]oxyethyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)CCN1CCC(OCCNC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H36N2O/c1-16(2,3)9-13-19-11-7-15(8-12-19)20-14-10-18-17(4,5)6/h15,18H,7-14H2,1-6H3 |
| InChIKey | NGRSULQMUWAFFW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[1-(3,3-dimethylbutyl)piperidin-4-yl]oxyethyl]-2-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[1-(3,3-dimethylbutyl)piperidin-4-yl]oxyethyl]-2-methylpropan-2-amine?
The IUPAC name of N-[2-[1-(3,3-dimethylbutyl)piperidin-4-yl]oxyethyl]-2-methylpropan-2-amine (CID 126671625) is N-[2-[1-(3,3-dimethylbutyl)piperidin-4-yl]oxyethyl]-2-methylpropan-2-amine.
What is the SMILES notation for N-[2-[1-(3,3-dimethylbutyl)piperidin-4-yl]oxyethyl]-2-methylpropan-2-amine?
The canonical SMILES for N-[2-[1-(3,3-dimethylbutyl)piperidin-4-yl]oxyethyl]-2-methylpropan-2-amine is CC(C)(C)CCN1CCC(OCCNC(C)(C)C)CC1.
What is the InChIKey of N-[2-[1-(3,3-dimethylbutyl)piperidin-4-yl]oxyethyl]-2-methylpropan-2-amine?
The InChIKey is NGRSULQMUWAFFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36N2O/c1-16(2,3)9-13-19-11-7-15(8-12-19)20-14-10-18-17(4,5)6/h15,18H,7-14H2,1-6H3.
What are the key properties of N-[2-[1-(3,3-dimethylbutyl)piperidin-4-yl]oxyethyl]-2-methylpropan-2-amine?
N-[2-[1-(3,3-dimethylbutyl)piperidin-4-yl]oxyethyl]-2-methylpropan-2-amine has a molecular weight of 284.49 g/mol, XLogP of 3.29, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[1-(3,3-dimethylbutyl)piperidin-4-yl]oxyethyl]-2-methylpropan-2-amine is sourced from PubChem (CID 126671625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).