About 2-(2-methoxyphenyl)-6-pyrrol-1-yl-4-(2,4,6-trimethylphenyl)phenol
2-(2-methoxyphenyl)-6-pyrrol-1-yl-4-(2,4,6-trimethylphenyl)phenol (PubChem CID 126672446) has the molecular formula C26H25NO2
and a molecular weight of 383.49 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-6-pyrrol-1-yl-4-(2,4,6-trimethylphenyl)phenol.
Molecular Properties
| Compound Name | 2-(2-methoxyphenyl)-6-pyrrol-1-yl-4-(2,4,6-trimethylphenyl)phenol |
| PubChem CID | 126672446 |
| Molecular Formula | C26H25NO2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 2-(2-methoxyphenyl)-6-pyrrol-1-yl-4-(2,4,6-trimethylphenyl)phenol |
| SMILES | COc1ccccc1-c1cc(-c2c(C)cc(C)cc2C)cc(-n2cccc2)c1O |
| InChI | InChI=1S/C26H25NO2/c1-17-13-18(2)25(19(3)14-17)20-15-22(21-9-5-6-10-24(21)29-4)26(28)23(16-20)27-11-7-8-12-27/h5-16,28H,1-4H3 |
| InChIKey | GGTWVEDIGDISLY-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-methoxyphenyl)-6-pyrrol-1-yl-4-(2,4,6-trimethylphenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxyphenyl)-6-pyrrol-1-yl-4-(2,4,6-trimethylphenyl)phenol?
The IUPAC name of 2-(2-methoxyphenyl)-6-pyrrol-1-yl-4-(2,4,6-trimethylphenyl)phenol (CID 126672446) is 2-(2-methoxyphenyl)-6-pyrrol-1-yl-4-(2,4,6-trimethylphenyl)phenol.
What is the SMILES notation for 2-(2-methoxyphenyl)-6-pyrrol-1-yl-4-(2,4,6-trimethylphenyl)phenol?
The canonical SMILES for 2-(2-methoxyphenyl)-6-pyrrol-1-yl-4-(2,4,6-trimethylphenyl)phenol is COc1ccccc1-c1cc(-c2c(C)cc(C)cc2C)cc(-n2cccc2)c1O.
What is the InChIKey of 2-(2-methoxyphenyl)-6-pyrrol-1-yl-4-(2,4,6-trimethylphenyl)phenol?
The InChIKey is GGTWVEDIGDISLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H25NO2/c1-17-13-18(2)25(19(3)14-17)20-15-22(21-9-5-6-10-24(21)29-4)26(28)23(16-20)27-11-7-8-12-27/h5-16,28H,1-4H3.
What are the key properties of 2-(2-methoxyphenyl)-6-pyrrol-1-yl-4-(2,4,6-trimethylphenyl)phenol?
2-(2-methoxyphenyl)-6-pyrrol-1-yl-4-(2,4,6-trimethylphenyl)phenol has a molecular weight of 383.49 g/mol, XLogP of 6.45, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxyphenyl)-6-pyrrol-1-yl-4-(2,4,6-trimethylphenyl)phenol is sourced from PubChem (CID 126672446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).