C14H14FNO2 — CID 126672571
(2E,3Z,5E)-6-amino-2-ethylidene-5-fluoro-6-phenylhexa-3,5-dienoic acid (PubChem CID 126672571) has the molecular formula C14H14FNO2 and a molecular weight of 247.27 g/mol. Its IUPAC name is (2E,3Z,5E)-6-amino-2-ethylidene-5-fluoro-6-phenylhexa-3,5-dienoic acid.
| Compound Name | (2E,3Z,5E)-6-amino-2-ethylidene-5-fluoro-6-phenylhexa-3,5-dienoic acid |
|---|---|
| PubChem CID | 126672571 |
| Molecular Formula | C14H14FNO2 |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | (2E,3Z,5E)-6-amino-2-ethylidene-5-fluoro-6-phenylhexa-3,5-dienoic acid |
| SMILES | C/C=C(\C=C/C(F)=C(\N)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H14FNO2/c1-2-10(14(17)18)8-9-12(15)13(16)11-6-4-3-5-7-11/h2-9H,16H2,1H3,(H,17,18)/b9-8-,10-2+,13-12+ |
| InChIKey | OXCQSOLNFSFALS-BPIHIHTESA-N |
| XLogP | 2.87 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|