C21H19N3O2 — CID 126672987
6-benzyl-3-(3,4-dimethoxyphenyl)imidazo[1,2-b]pyridazine (PubChem CID 126672987) has the molecular formula C21H19N3O2 and a molecular weight of 345.40 g/mol. Its IUPAC name is 6-benzyl-3-(3,4-dimethoxyphenyl)imidazo[1,2-b]pyridazine.
| Compound Name | 6-benzyl-3-(3,4-dimethoxyphenyl)imidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 126672987 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 6-benzyl-3-(3,4-dimethoxyphenyl)imidazo[1,2-b]pyridazine |
| SMILES | COc1ccc(-c2cnc3ccc(Cc4ccccc4)nn23)cc1OC |
| InChI | InChI=1S/C21H19N3O2/c1-25-19-10-8-16(13-20(19)26-2)18-14-22-21-11-9-17(23-24(18)21)12-15-6-4-3-5-7-15/h3-11,13-14H,12H2,1-2H3 |
| InChIKey | WLNDLXJBLQPIFZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |