C20H17ClN4O3 — CID 126673030
2-[7-(4-chlorophenyl)-5,13-dimethyl-12-oxo-4,5,8,13-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),3,7,10-pentaen-9-yl]acetic acid (PubChem CID 126673030) has the molecular formula C20H17ClN4O3 and a molecular weight of 396.83 g/mol. Its IUPAC name is 2-[7-(4-chlorophenyl)-5,13-dimethyl-12-oxo-4,5,8,13-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),3,7,10-pentaen-9-yl]acetic acid.
| Compound Name | 2-[7-(4-chlorophenyl)-5,13-dimethyl-12-oxo-4,5,8,13-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),3,7,10-pentaen-9-yl]acetic acid |
|---|---|
| PubChem CID | 126673030 |
| Molecular Formula | C20H17ClN4O3 |
| Molecular Weight | 396.83 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 2-[7-(4-chlorophenyl)-5,13-dimethyl-12-oxo-4,5,8,13-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),3,7,10-pentaen-9-yl]acetic acid |
| SMILES | Cn1ncc2c1C(c1ccc(Cl)cc1)=NC(CC(=O)O)c1cc(=O)n(C)cc1-2 |
| InChI | InChI=1S/C20H17ClN4O3/c1-24-10-15-13(7-17(24)26)16(8-18(27)28)23-19(11-3-5-12(21)6-4-11)20-14(15)9-22-25(20)2/h3-7,9-10,16H,8H2,1-2H3,(H,27,28) |
| InChIKey | VQNDPXDRPWAGOO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 89.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.83 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |