About 3-(6-phenylimidazo[1,2-a]pyrazin-3-yl)phenol
3-(6-phenylimidazo[1,2-a]pyrazin-3-yl)phenol (PubChem CID 126673041) has the molecular formula C18H13N3O
and a molecular weight of 287.32 g/mol. Its IUPAC name is 3-(6-phenylimidazo[1,2-a]pyrazin-3-yl)phenol.
Molecular Properties
| Compound Name | 3-(6-phenylimidazo[1,2-a]pyrazin-3-yl)phenol |
| PubChem CID | 126673041 |
| Molecular Formula | C18H13N3O |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 3-(6-phenylimidazo[1,2-a]pyrazin-3-yl)phenol |
| SMILES | Oc1cccc(-c2cnc3cnc(-c4ccccc4)cn23)c1 |
| InChI | InChI=1S/C18H13N3O/c22-15-8-4-7-14(9-15)17-10-20-18-11-19-16(12-21(17)18)13-5-2-1-3-6-13/h1-12,22H |
| InChIKey | VFOMPMMNRZWIOD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(6-phenylimidazo[1,2-a]pyrazin-3-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-phenylimidazo[1,2-a]pyrazin-3-yl)phenol?
The IUPAC name of 3-(6-phenylimidazo[1,2-a]pyrazin-3-yl)phenol (CID 126673041) is 3-(6-phenylimidazo[1,2-a]pyrazin-3-yl)phenol.
What is the SMILES notation for 3-(6-phenylimidazo[1,2-a]pyrazin-3-yl)phenol?
The canonical SMILES for 3-(6-phenylimidazo[1,2-a]pyrazin-3-yl)phenol is Oc1cccc(-c2cnc3cnc(-c4ccccc4)cn23)c1.
What is the InChIKey of 3-(6-phenylimidazo[1,2-a]pyrazin-3-yl)phenol?
The InChIKey is VFOMPMMNRZWIOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N3O/c22-15-8-4-7-14(9-15)17-10-20-18-11-19-16(12-21(17)18)13-5-2-1-3-6-13/h1-12,22H.
What are the key properties of 3-(6-phenylimidazo[1,2-a]pyrazin-3-yl)phenol?
3-(6-phenylimidazo[1,2-a]pyrazin-3-yl)phenol has a molecular weight of 287.32 g/mol, XLogP of 3.77, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-phenylimidazo[1,2-a]pyrazin-3-yl)phenol is sourced from PubChem (CID 126673041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).