C20H17N3O2 — CID 126673222
[4-[6-(3-methoxyphenyl)imidazo[1,2-b]pyridazin-3-yl]phenyl]methanol (PubChem CID 126673222) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is [4-[6-(3-methoxyphenyl)imidazo[1,2-b]pyridazin-3-yl]phenyl]methanol.
| Compound Name | [4-[6-(3-methoxyphenyl)imidazo[1,2-b]pyridazin-3-yl]phenyl]methanol |
|---|---|
| PubChem CID | 126673222 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | [4-[6-(3-methoxyphenyl)imidazo[1,2-b]pyridazin-3-yl]phenyl]methanol |
| SMILES | COc1cccc(-c2ccc3ncc(-c4ccc(CO)cc4)n3n2)c1 |
| InChI | InChI=1S/C20H17N3O2/c1-25-17-4-2-3-16(11-17)18-9-10-20-21-12-19(23(20)22-18)15-7-5-14(13-24)6-8-15/h2-12,24H,13H2,1H3 |
| InChIKey | AYYKPDFYGYNYRU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 59.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |