About 1-(2-amino-4,5-dimethylthiophen-3-yl)-2-cyclopropylethanone
1-(2-amino-4,5-dimethylthiophen-3-yl)-2-cyclopropylethanone (PubChem CID 126673235) has the molecular formula C11H15NOS
and a molecular weight of 209.31 g/mol. Its IUPAC name is 1-(2-amino-4,5-dimethylthiophen-3-yl)-2-cyclopropylethanone.
Molecular Properties
| Compound Name | 1-(2-amino-4,5-dimethylthiophen-3-yl)-2-cyclopropylethanone |
| PubChem CID | 126673235 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 1-(2-amino-4,5-dimethylthiophen-3-yl)-2-cyclopropylethanone |
| SMILES | Cc1sc(N)c(C(=O)CC2CC2)c1C |
| InChI | InChI=1S/C11H15NOS/c1-6-7(2)14-11(12)10(6)9(13)5-8-3-4-8/h8H,3-5,12H2,1-2H3 |
| InChIKey | SELDZNZGEYSIEB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-amino-4,5-dimethylthiophen-3-yl)-2-cyclopropylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-amino-4,5-dimethylthiophen-3-yl)-2-cyclopropylethanone?
The IUPAC name of 1-(2-amino-4,5-dimethylthiophen-3-yl)-2-cyclopropylethanone (CID 126673235) is 1-(2-amino-4,5-dimethylthiophen-3-yl)-2-cyclopropylethanone.
What is the SMILES notation for 1-(2-amino-4,5-dimethylthiophen-3-yl)-2-cyclopropylethanone?
The canonical SMILES for 1-(2-amino-4,5-dimethylthiophen-3-yl)-2-cyclopropylethanone is Cc1sc(N)c(C(=O)CC2CC2)c1C.
What is the InChIKey of 1-(2-amino-4,5-dimethylthiophen-3-yl)-2-cyclopropylethanone?
The InChIKey is SELDZNZGEYSIEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NOS/c1-6-7(2)14-11(12)10(6)9(13)5-8-3-4-8/h8H,3-5,12H2,1-2H3.
What are the key properties of 1-(2-amino-4,5-dimethylthiophen-3-yl)-2-cyclopropylethanone?
1-(2-amino-4,5-dimethylthiophen-3-yl)-2-cyclopropylethanone has a molecular weight of 209.31 g/mol, XLogP of 2.93, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-amino-4,5-dimethylthiophen-3-yl)-2-cyclopropylethanone is sourced from PubChem (CID 126673235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).