About N-butyl-3,5-ditert-butyl-2-hydroxybenzamide
N-butyl-3,5-ditert-butyl-2-hydroxybenzamide (PubChem CID 126673332) has the molecular formula C19H31NO2
and a molecular weight of 305.46 g/mol. Its IUPAC name is N-butyl-3,5-ditert-butyl-2-hydroxybenzamide.
Molecular Properties
| Compound Name | N-butyl-3,5-ditert-butyl-2-hydroxybenzamide |
| PubChem CID | 126673332 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | N-butyl-3,5-ditert-butyl-2-hydroxybenzamide |
| SMILES | CCCCNC(=O)c1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C19H31NO2/c1-8-9-10-20-17(22)14-11-13(18(2,3)4)12-15(16(14)21)19(5,6)7/h11-12,21H,8-10H2,1-7H3,(H,20,22) |
| InChIKey | QCZOVLATZXPSFR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-3,5-ditert-butyl-2-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-3,5-ditert-butyl-2-hydroxybenzamide?
The IUPAC name of N-butyl-3,5-ditert-butyl-2-hydroxybenzamide (CID 126673332) is N-butyl-3,5-ditert-butyl-2-hydroxybenzamide.
What is the SMILES notation for N-butyl-3,5-ditert-butyl-2-hydroxybenzamide?
The canonical SMILES for N-butyl-3,5-ditert-butyl-2-hydroxybenzamide is CCCCNC(=O)c1cc(C(C)(C)C)cc(C(C)(C)C)c1O.
What is the InChIKey of N-butyl-3,5-ditert-butyl-2-hydroxybenzamide?
The InChIKey is QCZOVLATZXPSFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31NO2/c1-8-9-10-20-17(22)14-11-13(18(2,3)4)12-15(16(14)21)19(5,6)7/h11-12,21H,8-10H2,1-7H3,(H,20,22).
What are the key properties of N-butyl-3,5-ditert-butyl-2-hydroxybenzamide?
N-butyl-3,5-ditert-butyl-2-hydroxybenzamide has a molecular weight of 305.46 g/mol, XLogP of 4.52, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-3,5-ditert-butyl-2-hydroxybenzamide is sourced from PubChem (CID 126673332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).