About (2R)-4,4-difluoro-1-iodo-5-oxopyrrolidine-2-carbaldehyde
(2R)-4,4-difluoro-1-iodo-5-oxopyrrolidine-2-carbaldehyde (PubChem CID 126673596) has the molecular formula C5H4F2INO2
and a molecular weight of 274.99 g/mol. Its IUPAC name is (2R)-4,4-difluoro-1-iodo-5-oxopyrrolidine-2-carbaldehyde.
Molecular Properties
| Compound Name | (2R)-4,4-difluoro-1-iodo-5-oxopyrrolidine-2-carbaldehyde |
| PubChem CID | 126673596 |
| Molecular Formula | C5H4F2INO2 |
| Molecular Weight | 274.99 g/mol |
| Exact Mass | 274.93 |
| IUPAC Name | (2R)-4,4-difluoro-1-iodo-5-oxopyrrolidine-2-carbaldehyde |
| SMILES | O=C[C@H]1CC(F)(F)C(=O)N1I |
| InChI | InChI=1S/C5H4F2INO2/c6-5(7)1-3(2-10)9(8)4(5)11/h2-3H,1H2/t3-/m1/s1 |
| InChIKey | BQMABWJHAPGOLW-GSVOUGTGSA-N |
| XLogP | 0.77 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.99 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze (2R)-4,4-difluoro-1-iodo-5-oxopyrrolidine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4,4-difluoro-1-iodo-5-oxopyrrolidine-2-carbaldehyde?
The IUPAC name of (2R)-4,4-difluoro-1-iodo-5-oxopyrrolidine-2-carbaldehyde (CID 126673596) is (2R)-4,4-difluoro-1-iodo-5-oxopyrrolidine-2-carbaldehyde.
What is the SMILES notation for (2R)-4,4-difluoro-1-iodo-5-oxopyrrolidine-2-carbaldehyde?
The canonical SMILES for (2R)-4,4-difluoro-1-iodo-5-oxopyrrolidine-2-carbaldehyde is O=C[C@H]1CC(F)(F)C(=O)N1I.
What is the InChIKey of (2R)-4,4-difluoro-1-iodo-5-oxopyrrolidine-2-carbaldehyde?
The InChIKey is BQMABWJHAPGOLW-GSVOUGTGSA-N. The full InChI is InChI=1S/C5H4F2INO2/c6-5(7)1-3(2-10)9(8)4(5)11/h2-3H,1H2/t3-/m1/s1.
What are the key properties of (2R)-4,4-difluoro-1-iodo-5-oxopyrrolidine-2-carbaldehyde?
(2R)-4,4-difluoro-1-iodo-5-oxopyrrolidine-2-carbaldehyde has a molecular weight of 274.99 g/mol, XLogP of 0.77, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4,4-difluoro-1-iodo-5-oxopyrrolidine-2-carbaldehyde is sourced from PubChem (CID 126673596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).