C17H15FN4O2 — CID 126673600
(3R,4R,5S)-3-azido-5-(3-fluorocarbazol-9-yl)oxan-4-ol (PubChem CID 126673600) has the molecular formula C17H15FN4O2 and a molecular weight of 326.33 g/mol. Its IUPAC name is (3R,4R,5S)-3-azido-5-(3-fluorocarbazol-9-yl)oxan-4-ol.
| Compound Name | (3R,4R,5S)-3-azido-5-(3-fluorocarbazol-9-yl)oxan-4-ol |
|---|---|
| PubChem CID | 126673600 |
| Molecular Formula | C17H15FN4O2 |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | (3R,4R,5S)-3-azido-5-(3-fluorocarbazol-9-yl)oxan-4-ol |
| SMILES | [N-]=[N+]=N[C@@H]1COC[C@H](n2c3ccccc3c3cc(F)ccc32)[C@H]1O |
| InChI | InChI=1S/C17H15FN4O2/c18-10-5-6-15-12(7-10)11-3-1-2-4-14(11)22(15)16-9-24-8-13(17(16)23)20-21-19/h1-7,13,16-17,23H,8-9H2/t13-,16+,17+/m1/s1 |
| InChIKey | KIZDUHOBKHCGOY-COXVUDFISA-N |
| XLogP | 3.54 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|