C23H23N3O5S — CID 126673697
4-amino-N-[(3R,4R,5S)-4-hydroxy-5-phenoxazin-10-yloxan-3-yl]benzenesulfonamide (PubChem CID 126673697) has the molecular formula C23H23N3O5S and a molecular weight of 453.52 g/mol. Its IUPAC name is 4-amino-N-[(3R,4R,5S)-4-hydroxy-5-phenoxazin-10-yloxan-3-yl]benzenesulfonamide.
| Compound Name | 4-amino-N-[(3R,4R,5S)-4-hydroxy-5-phenoxazin-10-yloxan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 126673697 |
| Molecular Formula | C23H23N3O5S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 4-amino-N-[(3R,4R,5S)-4-hydroxy-5-phenoxazin-10-yloxan-3-yl]benzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)N[C@@H]2COC[C@H](N3c4ccccc4Oc4ccccc43)[C@H]2O)cc1 |
| InChI | InChI=1S/C23H23N3O5S/c24-15-9-11-16(12-10-15)32(28,29)25-17-13-30-14-20(23(17)27)26-18-5-1-3-7-21(18)31-22-8-4-2-6-19(22)26/h1-12,17,20,23,25,27H,13-14,24H2/t17-,20+,23+/m1/s1 |
| InChIKey | HMLOAPNEVLDJNQ-MONBJTKQSA-N |
| XLogP | 2.62 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|