About 1-(1,3-benzothiazol-6-ylmethyl)-4-fluoro-N-(3-fluoropiperidin-4-yl)indole-3-carboxamide
1-(1,3-benzothiazol-6-ylmethyl)-4-fluoro-N-(3-fluoropiperidin-4-yl)indole-3-carboxamide (PubChem CID 126674026) has the molecular formula C22H20F2N4OS
and a molecular weight of 426.49 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-6-ylmethyl)-4-fluoro-N-(3-fluoropiperidin-4-yl)indole-3-carboxamide.
Molecular Properties
| Compound Name | 1-(1,3-benzothiazol-6-ylmethyl)-4-fluoro-N-(3-fluoropiperidin-4-yl)indole-3-carboxamide |
| PubChem CID | 126674026 |
| Molecular Formula | C22H20F2N4OS |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 1-(1,3-benzothiazol-6-ylmethyl)-4-fluoro-N-(3-fluoropiperidin-4-yl)indole-3-carboxamide |
| SMILES | O=C(NC1CCNCC1F)c1cn(Cc2ccc3ncsc3c2)c2cccc(F)c12 |
| InChI | InChI=1S/C22H20F2N4OS/c23-15-2-1-3-19-21(15)14(22(29)27-17-6-7-25-9-16(17)24)11-28(19)10-13-4-5-18-20(8-13)30-12-26-18/h1-5,8,11-12,16-17,25H,6-7,9-10H2,(H,27,29) |
| InChIKey | QJHMGGMHKOMXDA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(1,3-benzothiazol-6-ylmethyl)-4-fluoro-N-(3-fluoropiperidin-4-yl)indole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-benzothiazol-6-ylmethyl)-4-fluoro-N-(3-fluoropiperidin-4-yl)indole-3-carboxamide?
The IUPAC name of 1-(1,3-benzothiazol-6-ylmethyl)-4-fluoro-N-(3-fluoropiperidin-4-yl)indole-3-carboxamide (CID 126674026) is 1-(1,3-benzothiazol-6-ylmethyl)-4-fluoro-N-(3-fluoropiperidin-4-yl)indole-3-carboxamide.
What is the SMILES notation for 1-(1,3-benzothiazol-6-ylmethyl)-4-fluoro-N-(3-fluoropiperidin-4-yl)indole-3-carboxamide?
The canonical SMILES for 1-(1,3-benzothiazol-6-ylmethyl)-4-fluoro-N-(3-fluoropiperidin-4-yl)indole-3-carboxamide is O=C(NC1CCNCC1F)c1cn(Cc2ccc3ncsc3c2)c2cccc(F)c12.
What is the InChIKey of 1-(1,3-benzothiazol-6-ylmethyl)-4-fluoro-N-(3-fluoropiperidin-4-yl)indole-3-carboxamide?
The InChIKey is QJHMGGMHKOMXDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20F2N4OS/c23-15-2-1-3-19-21(15)14(22(29)27-17-6-7-25-9-16(17)24)11-28(19)10-13-4-5-18-20(8-13)30-12-26-18/h1-5,8,11-12,16-17,25H,6-7,9-10H2,(H,27,29).
What are the key properties of 1-(1,3-benzothiazol-6-ylmethyl)-4-fluoro-N-(3-fluoropiperidin-4-yl)indole-3-carboxamide?
1-(1,3-benzothiazol-6-ylmethyl)-4-fluoro-N-(3-fluoropiperidin-4-yl)indole-3-carboxamide has a molecular weight of 426.49 g/mol, XLogP of 3.87, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-benzothiazol-6-ylmethyl)-4-fluoro-N-(3-fluoropiperidin-4-yl)indole-3-carboxamide is sourced from PubChem (CID 126674026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).