C24H23F3N6S2 — CID 126674209
N-[(1S,5R)-3-(3-methyl-1,2-thiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-[4-(trifluoromethylsulfanyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 126674209) has the molecular formula C24H23F3N6S2 and a molecular weight of 516.62 g/mol. Its IUPAC name is N-[(1S,5R)-3-(3-methyl-1,2-thiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-[4-(trifluoromethylsulfanyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-[(1S,5R)-3-(3-methyl-1,2-thiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-[4-(trifluoromethylsulfanyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 126674209 |
| Molecular Formula | C24H23F3N6S2 |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | N-[(1S,5R)-3-(3-methyl-1,2-thiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-[4-(trifluoromethylsulfanyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1cc(N2C[C@H]3CC[C@@H](C2)C3Nc2nc3c(-c4ccc(SC(F)(F)F)cc4)cccn3n2)sn1 |
| InChI | InChI=1S/C24H23F3N6S2/c1-14-11-20(35-31-14)32-12-16-4-5-17(13-32)21(16)28-23-29-22-19(3-2-10-33(22)30-23)15-6-8-18(9-7-15)34-24(25,26)27/h2-3,6-11,16-17,21H,4-5,12-13H2,1H3,(H,28,30)/t16-,17+,21? |
| InChIKey | NDUAUVMOARZCOD-QRTHJKPMSA-N |
| XLogP | 6.10 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |