C24H22F4N6S — CID 126674232
8-[3-fluoro-5-(trifluoromethyl)phenyl]-N-[(1S,5R)-3-(3-methyl-1,2-thiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 126674232) has the molecular formula C24H22F4N6S and a molecular weight of 502.54 g/mol. Its IUPAC name is 8-[3-fluoro-5-(trifluoromethyl)phenyl]-N-[(1S,5R)-3-(3-methyl-1,2-thiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 8-[3-fluoro-5-(trifluoromethyl)phenyl]-N-[(1S,5R)-3-(3-methyl-1,2-thiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 126674232 |
| Molecular Formula | C24H22F4N6S |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | 8-[3-fluoro-5-(trifluoromethyl)phenyl]-N-[(1S,5R)-3-(3-methyl-1,2-thiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1cc(N2C[C@H]3CC[C@@H](C2)C3Nc2nc3c(-c4cc(F)cc(C(F)(F)F)c4)cccn3n2)sn1 |
| InChI | InChI=1S/C24H22F4N6S/c1-13-7-20(35-32-13)33-11-14-4-5-15(12-33)21(14)29-23-30-22-19(3-2-6-34(22)31-23)16-8-17(24(26,27)28)10-18(25)9-16/h2-3,6-10,14-15,21H,4-5,11-12H2,1H3,(H,29,31)/t14-,15+,21? |
| InChIKey | FCTWMAJRTCIGOD-YLQYIJTPSA-N |
| XLogP | 5.65 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |