C23H23F6N7O — CID 126674253
N-[3-(5-methyl-1,3,4-oxadiazol-2-yl)-3-azabicyclo[3.2.1]octan-8-yl]-5-(trifluoromethyl)-8-(2,3,4-trifluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 126674253) has the molecular formula C23H23F6N7O and a molecular weight of 527.47 g/mol. Its IUPAC name is N-[3-(5-methyl-1,3,4-oxadiazol-2-yl)-3-azabicyclo[3.2.1]octan-8-yl]-5-(trifluoromethyl)-8-(2,3,4-trifluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-[3-(5-methyl-1,3,4-oxadiazol-2-yl)-3-azabicyclo[3.2.1]octan-8-yl]-5-(trifluoromethyl)-8-(2,3,4-trifluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 126674253 |
| Molecular Formula | C23H23F6N7O |
| Molecular Weight | 527.47 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | N-[3-(5-methyl-1,3,4-oxadiazol-2-yl)-3-azabicyclo[3.2.1]octan-8-yl]-5-(trifluoromethyl)-8-(2,3,4-trifluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1nnc(N2CC3CCC(C2)C3Nc2nc3n(n2)C(C(F)(F)F)CCC3c2ccc(F)c(F)c2F)o1 |
| InChI | InChI=1S/C23H23F6N7O/c1-10-32-33-22(37-10)35-8-11-2-3-12(9-35)19(11)30-21-31-20-14(13-4-6-15(24)18(26)17(13)25)5-7-16(23(27,28)29)36(20)34-21/h4,6,11-12,14,16,19H,2-3,5,7-9H2,1H3,(H,30,34) |
| InChIKey | LZVPXQCHJKEILC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 84.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|