C24H25FN6S — CID 126674259
8-(4-fluoro-2-methylphenyl)-N-[(1S,5R)-3-(3-methyl-1,2-thiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 126674259) has the molecular formula C24H25FN6S and a molecular weight of 448.57 g/mol. Its IUPAC name is 8-(4-fluoro-2-methylphenyl)-N-[(1S,5R)-3-(3-methyl-1,2-thiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 8-(4-fluoro-2-methylphenyl)-N-[(1S,5R)-3-(3-methyl-1,2-thiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 126674259 |
| Molecular Formula | C24H25FN6S |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 8-(4-fluoro-2-methylphenyl)-N-[(1S,5R)-3-(3-methyl-1,2-thiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1cc(N2C[C@H]3CC[C@@H](C2)C3Nc2nc3c(-c4ccc(F)cc4C)cccn3n2)sn1 |
| InChI | InChI=1S/C24H25FN6S/c1-14-10-18(25)7-8-19(14)20-4-3-9-31-23(20)27-24(28-31)26-22-16-5-6-17(22)13-30(12-16)21-11-15(2)29-32-21/h3-4,7-11,16-17,22H,5-6,12-13H2,1-2H3,(H,26,28)/t16-,17+,22? |
| InChIKey | CTMHJVGVJRJETG-AQKKSAQBSA-N |
| XLogP | 4.94 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |