C24H24F2N6S — CID 126674278
8-[4-(difluoromethyl)phenyl]-N-[(1S,5R)-3-(3-methyl-1,2-thiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 126674278) has the molecular formula C24H24F2N6S and a molecular weight of 466.56 g/mol. Its IUPAC name is 8-[4-(difluoromethyl)phenyl]-N-[(1S,5R)-3-(3-methyl-1,2-thiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 8-[4-(difluoromethyl)phenyl]-N-[(1S,5R)-3-(3-methyl-1,2-thiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 126674278 |
| Molecular Formula | C24H24F2N6S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 8-[4-(difluoromethyl)phenyl]-N-[(1S,5R)-3-(3-methyl-1,2-thiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1cc(N2C[C@H]3CC[C@@H](C2)C3Nc2nc3c(-c4ccc(C(F)F)cc4)cccn3n2)sn1 |
| InChI | InChI=1S/C24H24F2N6S/c1-14-11-20(33-30-14)31-12-17-8-9-18(13-31)21(17)27-24-28-23-19(3-2-10-32(23)29-24)15-4-6-16(7-5-15)22(25)26/h2-7,10-11,17-18,21-22H,8-9,12-13H2,1H3,(H,27,29)/t17-,18+,21? |
| InChIKey | IFGOLXIJRCXJDB-HTZLVSCSSA-N |
| XLogP | 5.43 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |