C35H31IO8 — CID 126674474
tert-butyl [2-(5-iodofuran-2-yl)-19-[(2-methylpropan-2-yl)oxycarbonyloxy]-13-oxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4(9),5,7,10,15,17(22),18,20-decaen-7-yl] carbonate (PubChem CID 126674474) has the molecular formula C35H31IO8 and a molecular weight of 706.53 g/mol. Its IUPAC name is tert-butyl [2-(5-iodofuran-2-yl)-19-[(2-methylpropan-2-yl)oxycarbonyloxy]-13-oxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4(9),5,7,10,15,17(22),18,20-decaen-7-yl] carbonate.
| Compound Name | tert-butyl [2-(5-iodofuran-2-yl)-19-[(2-methylpropan-2-yl)oxycarbonyloxy]-13-oxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4(9),5,7,10,15,17(22),18,20-decaen-7-yl] carbonate |
|---|---|
| PubChem CID | 126674474 |
| Molecular Formula | C35H31IO8 |
| Molecular Weight | 706.53 g/mol |
| Exact Mass | 706.11 |
| IUPAC Name | tert-butyl [2-(5-iodofuran-2-yl)-19-[(2-methylpropan-2-yl)oxycarbonyloxy]-13-oxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4(9),5,7,10,15,17(22),18,20-decaen-7-yl] carbonate |
| SMILES | CC(C)(C)OC(=O)Oc1ccc2c3c(ccc2c1)Oc1ccc2cc(OC(=O)OC(C)(C)C)ccc2c1C3c1ccc(I)o1 |
| InChI | InChI=1S/C35H31IO8/c1-34(2,3)43-32(37)39-21-9-11-23-19(17-21)7-13-25-29(23)31(27-15-16-28(36)42-27)30-24-12-10-22(40-33(38)44-35(4,5)6)18-20(24)8-14-26(30)41-25/h7-18,31H,1-6H3 |
| InChIKey | VVEHJEMQPBYFQZ-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 93.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.53 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|