C12H11Cl3F3NO5 — CID 126674575
2,2,2-trichloroethyl N-[3-(hydroxymethyl)-2-methoxy-5-(trifluoromethoxy)phenyl]carbamate (PubChem CID 126674575) has the molecular formula C12H11Cl3F3NO5 and a molecular weight of 412.58 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[3-(hydroxymethyl)-2-methoxy-5-(trifluoromethoxy)phenyl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[3-(hydroxymethyl)-2-methoxy-5-(trifluoromethoxy)phenyl]carbamate |
|---|---|
| PubChem CID | 126674575 |
| Molecular Formula | C12H11Cl3F3NO5 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 410.97 |
| IUPAC Name | 2,2,2-trichloroethyl N-[3-(hydroxymethyl)-2-methoxy-5-(trifluoromethoxy)phenyl]carbamate |
| SMILES | COc1c(CO)cc(OC(F)(F)F)cc1NC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H11Cl3F3NO5/c1-22-9-6(4-20)2-7(24-12(16,17)18)3-8(9)19-10(21)23-5-11(13,14)15/h2-3,20H,4-5H2,1H3,(H,19,21) |
| InChIKey | ARRWVCWNVGTIGB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|