C9H12OS — CID 126675065
3,5,7,8-tetrahydro-2H-1,4-benzoxathiepine (PubChem CID 126675065) has the molecular formula C9H12OS and a molecular weight of 168.26 g/mol. Its IUPAC name is 3,5,7,8-tetrahydro-2H-1,4-benzoxathiepine.
| Compound Name | 3,5,7,8-tetrahydro-2H-1,4-benzoxathiepine |
|---|---|
| PubChem CID | 126675065 |
| Molecular Formula | C9H12OS |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | 3,5,7,8-tetrahydro-2H-1,4-benzoxathiepine |
| SMILES | C1=C2CSCCOC2=CCC1 |
| InChI | InChI=1S/C9H12OS/c1-2-4-9-8(3-1)7-11-6-5-10-9/h3-4H,1-2,5-7H2 |
| InChIKey | IWFMXGIVZLFPBC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |