C13H24N4 — CID 126675709
(3E,5E)-4-[(Z)-2-methanimidoylbut-2-enyl]-2-N-methylhepta-3,5-diene-2,3,6-triamine (PubChem CID 126675709) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is (3E,5E)-4-[(Z)-2-methanimidoylbut-2-enyl]-2-N-methylhepta-3,5-diene-2,3,6-triamine.
| Compound Name | (3E,5E)-4-[(Z)-2-methanimidoylbut-2-enyl]-2-N-methylhepta-3,5-diene-2,3,6-triamine |
|---|---|
| PubChem CID | 126675709 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | (3E,5E)-4-[(Z)-2-methanimidoylbut-2-enyl]-2-N-methylhepta-3,5-diene-2,3,6-triamine |
| SMILES | [H]/N=C/C(=C\C)CC(/C=C(\C)N)=C(\N)C(C)NC |
| InChI | InChI=1S/C13H24N4/c1-5-11(8-14)7-12(6-9(2)15)13(16)10(3)17-4/h5-6,8,10,14,17H,7,15-16H2,1-4H3/b9-6+,11-5-,13-12-,14-8+ |
| InChIKey | VQSFXQXSDFZHAE-VCABCHOHSA-N |
| XLogP | 1.66 |
| TPSA | 87.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|