C12H22N4 — CID 126675827
(E,2Z)-4-[(Z)-2-amino-2-(methylideneamino)ethenyl]-2-ethylidene-5-N-methylhex-4-ene-1,5-diamine (PubChem CID 126675827) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is (E,2Z)-4-[(Z)-2-amino-2-(methylideneamino)ethenyl]-2-ethylidene-5-N-methylhex-4-ene-1,5-diamine.
| Compound Name | (E,2Z)-4-[(Z)-2-amino-2-(methylideneamino)ethenyl]-2-ethylidene-5-N-methylhex-4-ene-1,5-diamine |
|---|---|
| PubChem CID | 126675827 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | (E,2Z)-4-[(Z)-2-amino-2-(methylideneamino)ethenyl]-2-ethylidene-5-N-methylhex-4-ene-1,5-diamine |
| SMILES | C=N/C(N)=C\C(C/C(=C/C)CN)=C(/C)NC |
| InChI | InChI=1S/C12H22N4/c1-5-10(8-13)6-11(9(2)15-3)7-12(14)16-4/h5,7,15H,4,6,8,13-14H2,1-3H3/b10-5-,11-9+,12-7- |
| InChIKey | GAQGGZIWEWMOBO-RFJNWZHGSA-N |
| XLogP | 1.28 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|