C65H59F3N8O2 — CID 126675836
tert-butyl 4-[3-[[5-(trifluoromethyl)-4-[[3-trityl-5-(tritylamino)triazolo[4,5-b]pyridin-7-yl]methyl]pyrazol-1-yl]methyl]phenyl]piperidine-1-carboxylate (PubChem CID 126675836) has the molecular formula C65H59F3N8O2 and a molecular weight of 1041.24 g/mol. Its IUPAC name is tert-butyl 4-[3-[[5-(trifluoromethyl)-4-[[3-trityl-5-(tritylamino)triazolo[4,5-b]pyridin-7-yl]methyl]pyrazol-1-yl]methyl]phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[[5-(trifluoromethyl)-4-[[3-trityl-5-(tritylamino)triazolo[4,5-b]pyridin-7-yl]methyl]pyrazol-1-yl]methyl]phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 126675836 |
| Molecular Formula | C65H59F3N8O2 |
| Molecular Weight | 1041.24 g/mol |
| Exact Mass | 1040.47 |
| IUPAC Name | tert-butyl 4-[3-[[5-(trifluoromethyl)-4-[[3-trityl-5-(tritylamino)triazolo[4,5-b]pyridin-7-yl]methyl]pyrazol-1-yl]methyl]phenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cccc(Cn3ncc(Cc4cc(NC(c5ccccc5)(c5ccccc5)c5ccccc5)nc5c4nnn5C(c4ccccc4)(c4ccccc4)c4ccccc4)c3C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C65H59F3N8O2/c1-62(2,3)78-61(77)74-39-37-47(38-40-74)48-24-22-23-46(41-48)45-75-59(65(66,67)68)50(44-69-75)42-49-43-57(71-63(51-25-10-4-11-26-51,52-27-12-5-13-28-52)53-29-14-6-15-30-53)70-60-58(49)72-73-76(60)64(54-31-16-7-17-32-54,55-33-18-8-19-34-55)56-35-20-9-21-36-56/h4-36,41,43-44,47H,37-40,42,45H2,1-3H3,(H,70,71) |
| InChIKey | WLQSFPVHDSJMDS-UHFFFAOYSA-N |
| XLogP | 14.04 |
| TPSA | 102.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1041.24 |
| LogP ≤ 5 | 14.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|