About 4-nitroso-N-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide
4-nitroso-N-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide (PubChem CID 126676229) has the molecular formula C16H10F3N5O3
and a molecular weight of 377.28 g/mol. Its IUPAC name is 4-nitroso-N-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide.
Molecular Properties
| Compound Name | 4-nitroso-N-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide |
| PubChem CID | 126676229 |
| Molecular Formula | C16H10F3N5O3 |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 4-nitroso-N-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide |
| SMILES | O=Nc1ccc(C(=O)Nc2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C16H10F3N5O3/c17-16(18,19)27-13-7-5-12(6-8-13)24-9-20-15(22-24)21-14(25)10-1-3-11(23-26)4-2-10/h1-9H,(H,21,22,25) |
| InChIKey | JPAQJAIZIBLGLN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-nitroso-N-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitroso-N-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide?
The IUPAC name of 4-nitroso-N-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide (CID 126676229) is 4-nitroso-N-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide.
What is the SMILES notation for 4-nitroso-N-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide?
The canonical SMILES for 4-nitroso-N-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide is O=Nc1ccc(C(=O)Nc2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1.
What is the InChIKey of 4-nitroso-N-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide?
The InChIKey is JPAQJAIZIBLGLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10F3N5O3/c17-16(18,19)27-13-7-5-12(6-8-13)24-9-20-15(22-24)21-14(25)10-1-3-11(23-26)4-2-10/h1-9H,(H,21,22,25).
What are the key properties of 4-nitroso-N-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide?
4-nitroso-N-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide has a molecular weight of 377.28 g/mol, XLogP of 3.82, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitroso-N-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide is sourced from PubChem (CID 126676229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).