C11H20N4 — CID 126676264
(2E,4Z)-5-N-methyl-3-[(E)-2-methyl-3-(methylideneamino)prop-2-enyl]penta-2,4-diene-1,2,5-triamine (PubChem CID 126676264) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is (2E,4Z)-5-N-methyl-3-[(E)-2-methyl-3-(methylideneamino)prop-2-enyl]penta-2,4-diene-1,2,5-triamine.
| Compound Name | (2E,4Z)-5-N-methyl-3-[(E)-2-methyl-3-(methylideneamino)prop-2-enyl]penta-2,4-diene-1,2,5-triamine |
|---|---|
| PubChem CID | 126676264 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | (2E,4Z)-5-N-methyl-3-[(E)-2-methyl-3-(methylideneamino)prop-2-enyl]penta-2,4-diene-1,2,5-triamine |
| SMILES | C=N/C=C(\C)CC(/C=C\NC)=C(\N)CN |
| InChI | InChI=1S/C11H20N4/c1-9(8-15-3)6-10(4-5-14-2)11(13)7-12/h4-5,8,14H,3,6-7,12-13H2,1-2H3/b5-4-,9-8+,11-10- |
| InChIKey | MSFZKLQEBADMEM-QXZHCYTBSA-N |
| XLogP | 0.89 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|