C24H22F3N3O3 — CID 126676672
3-[2-[4-[[3-(trifluoromethoxy)phenyl]methoxy]phenyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]propanal (PubChem CID 126676672) has the molecular formula C24H22F3N3O3 and a molecular weight of 457.45 g/mol. Its IUPAC name is 3-[2-[4-[[3-(trifluoromethoxy)phenyl]methoxy]phenyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]propanal.
| Compound Name | 3-[2-[4-[[3-(trifluoromethoxy)phenyl]methoxy]phenyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]propanal |
|---|---|
| PubChem CID | 126676672 |
| Molecular Formula | C24H22F3N3O3 |
| Molecular Weight | 457.45 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 3-[2-[4-[[3-(trifluoromethoxy)phenyl]methoxy]phenyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]propanal |
| SMILES | O=CCCN1CCc2nc(-c3ccc(OCc4cccc(OC(F)(F)F)c4)cc3)ncc2C1 |
| InChI | InChI=1S/C24H22F3N3O3/c25-24(26,27)33-21-4-1-3-17(13-21)16-32-20-7-5-18(6-8-20)23-28-14-19-15-30(10-2-12-31)11-9-22(19)29-23/h1,3-8,12-14H,2,9-11,15-16H2 |
| InChIKey | JTSYKZOQSWYWHU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|