C18H26FNO5S — CID 126676776
tert-butyl 4-[(4-fluorophenyl)methyl]-2-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate (PubChem CID 126676776) has the molecular formula C18H26FNO5S and a molecular weight of 387.47 g/mol. Its IUPAC name is tert-butyl 4-[(4-fluorophenyl)methyl]-2-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-fluorophenyl)methyl]-2-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 126676776 |
| Molecular Formula | C18H26FNO5S |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | tert-butyl 4-[(4-fluorophenyl)methyl]-2-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(Cc2ccc(F)cc2)CC1COS(C)(=O)=O |
| InChI | InChI=1S/C18H26FNO5S/c1-18(2,3)25-17(21)20-11-14(9-13-5-7-15(19)8-6-13)10-16(20)12-24-26(4,22)23/h5-8,14,16H,9-12H2,1-4H3 |
| InChIKey | MWXWKDIBNTWGTE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|