About 6-[[2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]methyl]-1-methylindazole
6-[[2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]methyl]-1-methylindazole (PubChem CID 126677790) has the molecular formula C26H27N5
and a molecular weight of 409.54 g/mol. Its IUPAC name is 6-[[2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]methyl]-1-methylindazole.
Molecular Properties
| Compound Name | 6-[[2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]methyl]-1-methylindazole |
| PubChem CID | 126677790 |
| Molecular Formula | C26H27N5 |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | 6-[[2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]methyl]-1-methylindazole |
| SMILES | Cc1ccc(C)n1-c1cc(Cc2ccc3cnn(C)c3c2)cc(-n2c(C)ccc2C)n1 |
| InChI | InChI=1S/C26H27N5/c1-17-6-7-18(2)30(17)25-14-22(15-26(28-25)31-19(3)8-9-20(31)4)12-21-10-11-23-16-27-29(5)24(23)13-21/h6-11,13-16H,12H2,1-5H3 |
| InChIKey | IVOZUIGRTZEXKS-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 40.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|
Analyze 6-[[2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]methyl]-1-methylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]methyl]-1-methylindazole?
The IUPAC name of 6-[[2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]methyl]-1-methylindazole (CID 126677790) is 6-[[2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]methyl]-1-methylindazole.
What is the SMILES notation for 6-[[2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]methyl]-1-methylindazole?
The canonical SMILES for 6-[[2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]methyl]-1-methylindazole is Cc1ccc(C)n1-c1cc(Cc2ccc3cnn(C)c3c2)cc(-n2c(C)ccc2C)n1.
What is the InChIKey of 6-[[2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]methyl]-1-methylindazole?
The InChIKey is IVOZUIGRTZEXKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27N5/c1-17-6-7-18(2)30(17)25-14-22(15-26(28-25)31-19(3)8-9-20(31)4)12-21-10-11-23-16-27-29(5)24(23)13-21/h6-11,13-16H,12H2,1-5H3.
What are the key properties of 6-[[2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]methyl]-1-methylindazole?
6-[[2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]methyl]-1-methylindazole has a molecular weight of 409.54 g/mol, XLogP of 5.37, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]methyl]-1-methylindazole is sourced from PubChem (CID 126677790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).