About 8-O-tert-butyl 2-O-methyl 3-(trifluoromethylsulfonyloxy)-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate
8-O-tert-butyl 2-O-methyl 3-(trifluoromethylsulfonyloxy)-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate (PubChem CID 126678393) has the molecular formula C15H20F3NO7S
and a molecular weight of 415.39 g/mol. Its IUPAC name is 8-O-tert-butyl 2-O-methyl 3-(trifluoromethylsulfonyloxy)-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate.
Molecular Properties
| Compound Name | 8-O-tert-butyl 2-O-methyl 3-(trifluoromethylsulfonyloxy)-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate |
| PubChem CID | 126678393 |
| Molecular Formula | C15H20F3NO7S |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 8-O-tert-butyl 2-O-methyl 3-(trifluoromethylsulfonyloxy)-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate |
| SMILES | COC(=O)C1=C(OS(=O)(=O)C(F)(F)F)CC2CCC1N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H20F3NO7S/c1-14(2,3)25-13(21)19-8-5-6-9(19)11(12(20)24-4)10(7-8)26-27(22,23)15(16,17)18/h8-9H,5-7H2,1-4H3 |
| InChIKey | WPGMCSHMQFLYGZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 8-O-tert-butyl 2-O-methyl 3-(trifluoromethylsulfonyloxy)-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-O-tert-butyl 2-O-methyl 3-(trifluoromethylsulfonyloxy)-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate?
The IUPAC name of 8-O-tert-butyl 2-O-methyl 3-(trifluoromethylsulfonyloxy)-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate (CID 126678393) is 8-O-tert-butyl 2-O-methyl 3-(trifluoromethylsulfonyloxy)-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate.
What is the SMILES notation for 8-O-tert-butyl 2-O-methyl 3-(trifluoromethylsulfonyloxy)-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate?
The canonical SMILES for 8-O-tert-butyl 2-O-methyl 3-(trifluoromethylsulfonyloxy)-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate is COC(=O)C1=C(OS(=O)(=O)C(F)(F)F)CC2CCC1N2C(=O)OC(C)(C)C.
What is the InChIKey of 8-O-tert-butyl 2-O-methyl 3-(trifluoromethylsulfonyloxy)-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate?
The InChIKey is WPGMCSHMQFLYGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20F3NO7S/c1-14(2,3)25-13(21)19-8-5-6-9(19)11(12(20)24-4)10(7-8)26-27(22,23)15(16,17)18/h8-9H,5-7H2,1-4H3.
What are the key properties of 8-O-tert-butyl 2-O-methyl 3-(trifluoromethylsulfonyloxy)-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate?
8-O-tert-butyl 2-O-methyl 3-(trifluoromethylsulfonyloxy)-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate has a molecular weight of 415.39 g/mol, XLogP of 2.45, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 8-O-tert-butyl 2-O-methyl 3-(trifluoromethylsulfonyloxy)-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate is sourced from PubChem (CID 126678393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).