C22H35FN8O4 — CID 126678601
N-[(2S)-1-[(2S)-2-[[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]-1-methylpyrazole-4-carboxamide (PubChem CID 126678601) has the molecular formula C22H35FN8O4 and a molecular weight of 494.57 g/mol. Its IUPAC name is N-[(2S)-1-[(2S)-2-[[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[(2S)-1-[(2S)-2-[[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 126678601 |
| Molecular Formula | C22H35FN8O4 |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | N-[(2S)-1-[(2S)-2-[[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]-1-methylpyrazole-4-carboxamide |
| SMILES | CC(C)[C@H](NC(=O)c1cnn(C)c1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCN=C(N)N)C(=O)CF |
| InChI | InChI=1S/C22H35FN8O4/c1-13(2)18(29-19(33)14-11-27-30(3)12-14)21(35)31-9-5-7-16(31)20(34)28-15(17(32)10-23)6-4-8-26-22(24)25/h11-13,15-16,18H,4-10H2,1-3H3,(H,28,34)(H,29,33)(H4,24,25,26)/t15-,16-,18-/m0/s1 |
| InChIKey | UTMNTJWVZBZFFO-BQFCYCMXSA-N |
| XLogP | -0.76 |
| TPSA | 177.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|