C12H21N3 — CID 126678672
(1Z,3E)-1-hydrazinyl-2-methyl-N,N-bis(prop-2-enyl)penta-1,3-dien-3-amine (PubChem CID 126678672) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is (1Z,3E)-1-hydrazinyl-2-methyl-N,N-bis(prop-2-enyl)penta-1,3-dien-3-amine.
| Compound Name | (1Z,3E)-1-hydrazinyl-2-methyl-N,N-bis(prop-2-enyl)penta-1,3-dien-3-amine |
|---|---|
| PubChem CID | 126678672 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | (1Z,3E)-1-hydrazinyl-2-methyl-N,N-bis(prop-2-enyl)penta-1,3-dien-3-amine |
| SMILES | C=CCN(CC=C)C(=C/C)/C(C)=C\NN |
| InChI | InChI=1S/C12H21N3/c1-5-8-15(9-6-2)12(7-3)11(4)10-14-13/h5-7,10,14H,1-2,8-9,13H2,3-4H3/b11-10-,12-7+ |
| InChIKey | HHHDENWSFSYGBC-LVILPVEGSA-N |
| XLogP | 1.93 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|