C18H30N2 — CID 126678821
2-N-ethenyl-3-N-[(3E,4Z)-3-ethylidene-4-methylhepta-1,4-dien-2-yl]hex-1-ene-2,3-diamine (PubChem CID 126678821) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is 2-N-ethenyl-3-N-[(3E,4Z)-3-ethylidene-4-methylhepta-1,4-dien-2-yl]hex-1-ene-2,3-diamine.
| Compound Name | 2-N-ethenyl-3-N-[(3E,4Z)-3-ethylidene-4-methylhepta-1,4-dien-2-yl]hex-1-ene-2,3-diamine |
|---|---|
| PubChem CID | 126678821 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | 2-N-ethenyl-3-N-[(3E,4Z)-3-ethylidene-4-methylhepta-1,4-dien-2-yl]hex-1-ene-2,3-diamine |
| SMILES | C=CNC(=C)C(CCC)NC(=C)C(=C/C)/C(C)=C\CC |
| InChI | InChI=1S/C18H30N2/c1-8-12-14(5)17(10-3)15(6)20-18(13-9-2)16(7)19-11-4/h10-12,18-20H,4,6-9,13H2,1-3,5H3/b14-12-,17-10+ |
| InChIKey | FGRDRTRBIABWPW-BNDDZXOOSA-N |
| XLogP | 4.81 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|