C27H36FN7O4 — CID 126679423
N-[(2S)-1-[(2S)-2-[[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]quinoline-3-carboxamide (PubChem CID 126679423) has the molecular formula C27H36FN7O4 and a molecular weight of 541.63 g/mol. Its IUPAC name is N-[(2S)-1-[(2S)-2-[[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]quinoline-3-carboxamide.
| Compound Name | N-[(2S)-1-[(2S)-2-[[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 126679423 |
| Molecular Formula | C27H36FN7O4 |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | N-[(2S)-1-[(2S)-2-[[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]quinoline-3-carboxamide |
| SMILES | CC(C)[C@H](NC(=O)c1cnc2ccccc2c1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCN=C(N)N)C(=O)CF |
| InChI | InChI=1S/C27H36FN7O4/c1-16(2)23(34-24(37)18-13-17-7-3-4-8-19(17)32-15-18)26(39)35-12-6-10-21(35)25(38)33-20(22(36)14-28)9-5-11-31-27(29)30/h3-4,7-8,13,15-16,20-21,23H,5-6,9-12,14H2,1-2H3,(H,33,38)(H,34,37)(H4,29,30,31)/t20-,21-,23-/m0/s1 |
| InChIKey | RRMXEGOEMYSDGE-FUDKSRODSA-N |
| XLogP | 1.06 |
| TPSA | 172.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|