C27H36FN7O4S — CID 126679444
N-[(2S)-1-[(2S)-2-[[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]-5-phenyl-1,3-thiazole-2-carboxamide (PubChem CID 126679444) has the molecular formula C27H36FN7O4S and a molecular weight of 573.70 g/mol. Its IUPAC name is N-[(2S)-1-[(2S)-2-[[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]-5-phenyl-1,3-thiazole-2-carboxamide.
| Compound Name | N-[(2S)-1-[(2S)-2-[[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]-5-phenyl-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 126679444 |
| Molecular Formula | C27H36FN7O4S |
| Molecular Weight | 573.70 g/mol |
| Exact Mass | 573.25 |
| IUPAC Name | N-[(2S)-1-[(2S)-2-[[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]-5-phenyl-1,3-thiazole-2-carboxamide |
| SMILES | CC(C)[C@H](NC(=O)c1ncc(-c2ccccc2)s1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCN=C(N)N)C(=O)CF |
| InChI | InChI=1S/C27H36FN7O4S/c1-16(2)22(34-24(38)25-32-15-21(40-25)17-8-4-3-5-9-17)26(39)35-13-7-11-19(35)23(37)33-18(20(36)14-28)10-6-12-31-27(29)30/h3-5,8-9,15-16,18-19,22H,6-7,10-14H2,1-2H3,(H,33,37)(H,34,38)(H4,29,30,31)/t18-,19-,22-/m0/s1 |
| InChIKey | XPAXBFLMLPHQFK-IPJJNNNSSA-N |
| XLogP | 1.63 |
| TPSA | 172.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.70 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|